methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate

C10H15N3O4S — CID 103105768

IUPACmethyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate
SMILESCCc1c(C(=O)OC)nnn1C1CCS(=O)(=O)C1
InChIInChI=1S/C10H15N3O4S/c1-3-8-9(10(14)17-2)11-12-13(8)7-4-5-18(15,16)6-7/h7H,3-6H2,1-2H3
InChIKeySHDRSLFORCXPGZ-UHFFFAOYSA-N
MW273.31 g/mol
LogP-0.01
Rot. Bonds3

About methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate

methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate (PubChem CID 103105768) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate
PubChem CID103105768
Molecular FormulaC10H15N3O4S
Molecular Weight273.31 g/mol
Exact Mass273.08
IUPAC Namemethyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate
SMILESCCc1c(C(=O)OC)nnn1C1CCS(=O)(=O)C1
InChIInChI=1S/C10H15N3O4S/c1-3-8-9(10(14)17-2)11-12-13(8)7-4-5-18(15,16)6-7/h7H,3-6H2,1-2H3
InChIKeySHDRSLFORCXPGZ-UHFFFAOYSA-N
XLogP-0.01
TPSA91.15 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.31
LogP ≤ 5-0.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate?
The IUPAC name of methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate (CID 103105768) is methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate.
What is the SMILES notation for methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate?
The canonical SMILES for methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate is CCc1c(C(=O)OC)nnn1C1CCS(=O)(=O)C1.
What is the InChIKey of methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate?
The InChIKey is SHDRSLFORCXPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4S/c1-3-8-9(10(14)17-2)11-12-13(8)7-4-5-18(15,16)6-7/h7H,3-6H2,1-2H3.
What are the key properties of methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate?
methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate has a molecular weight of 273.31 g/mol, XLogP of -0.01, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,1-dioxothiolan-3-yl)-5-ethyltriazole-4-carboxylate is sourced from PubChem (CID 103105768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).