1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid

C9H12N2O5S — CID 117231837

IUPAC1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid
SMILESCOc1cnn(C2CCS(=O)(=O)C2)c1C(=O)O
InChIInChI=1S/C9H12N2O5S/c1-16-7-4-10-11(8(7)9(12)13)6-2-3-17(14,15)5-6/h4,6H,2-3,5H2,1H3,(H,12,13)
InChIKeyOJJUHEBSEDPZOC-UHFFFAOYSA-N
MW260.27 g/mol
LogP-0.05
Rot. Bonds3

About 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid

1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid (PubChem CID 117231837) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid.

Molecular Properties

Compound Name1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid
PubChem CID117231837
Molecular FormulaC9H12N2O5S
Molecular Weight260.27 g/mol
Exact Mass260.05
IUPAC Name1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid
SMILESCOc1cnn(C2CCS(=O)(=O)C2)c1C(=O)O
InChIInChI=1S/C9H12N2O5S/c1-16-7-4-10-11(8(7)9(12)13)6-2-3-17(14,15)5-6/h4,6H,2-3,5H2,1H3,(H,12,13)
InChIKeyOJJUHEBSEDPZOC-UHFFFAOYSA-N
XLogP-0.05
TPSA98.49 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.27
LogP ≤ 5-0.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid (CID 117231837) is 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid is COc1cnn(C2CCS(=O)(=O)C2)c1C(=O)O.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid?
The InChIKey is OJJUHEBSEDPZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O5S/c1-16-7-4-10-11(8(7)9(12)13)6-2-3-17(14,15)5-6/h4,6H,2-3,5H2,1H3,(H,12,13).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid?
1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid has a molecular weight of 260.27 g/mol, XLogP of -0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid is sourced from PubChem (CID 117231837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).