C9H12N2O5S — CID 117231837
1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid (PubChem CID 117231837) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117231837 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methoxypyrazole-5-carboxylic acid |
| SMILES | COc1cnn(C2CCS(=O)(=O)C2)c1C(=O)O |
| InChI | InChI=1S/C9H12N2O5S/c1-16-7-4-10-11(8(7)9(12)13)6-2-3-17(14,15)5-6/h4,6H,2-3,5H2,1H3,(H,12,13) |
| InChIKey | OJJUHEBSEDPZOC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |