C14H27N3O — CID 82699797
2-[1-(3-ethoxypropyl)-3,5-diethylpyrazol-4-yl]ethanamine (PubChem CID 82699797) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropyl)-3,5-diethylpyrazol-4-yl]ethanamine.
| Compound Name | 2-[1-(3-ethoxypropyl)-3,5-diethylpyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 82699797 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2-[1-(3-ethoxypropyl)-3,5-diethylpyrazol-4-yl]ethanamine |
| SMILES | CCOCCCn1nc(CC)c(CCN)c1CC |
| InChI | InChI=1S/C14H27N3O/c1-4-13-12(8-9-15)14(5-2)17(16-13)10-7-11-18-6-3/h4-11,15H2,1-3H3 |
| InChIKey | RPIVQRAVKUNWBN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|