C5H12O5 — CID 827
pentane-1,2,3,4,5-pentol (PubChem CID 827) has the molecular formula C5H12O5 and a molecular weight of 152.15 g/mol. Its IUPAC name is pentane-1,2,3,4,5-pentol.
| Compound Name | pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 827 |
| Molecular Formula | C5H12O5 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | pentane-1,2,3,4,5-pentol |
| SMILES | OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2 |
| InChIKey | HEBKCHPVOIAQTA-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |