C20H31N3 — CID 82700730
1-(1-benzyl-3,5-diethylpyrazol-4-yl)-N-propylpropan-1-amine (PubChem CID 82700730) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-diethylpyrazol-4-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(1-benzyl-3,5-diethylpyrazol-4-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 82700730 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-(1-benzyl-3,5-diethylpyrazol-4-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1c(CC)nn(Cc2ccccc2)c1CC |
| InChI | InChI=1S/C20H31N3/c1-5-14-21-17(6-2)20-18(7-3)22-23(19(20)8-4)15-16-12-10-9-11-13-16/h9-13,17,21H,5-8,14-15H2,1-4H3 |
| InChIKey | ZYRZTALTBSWQDU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |