C11H19ClF3NO2 — CID 82701438
4-(2-chloroethoxy)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine (PubChem CID 82701438) has the molecular formula C11H19ClF3NO2 and a molecular weight of 289.73 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine.
| Compound Name | 4-(2-chloroethoxy)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 82701438 |
| Molecular Formula | C11H19ClF3NO2 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-(2-chloroethoxy)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
| SMILES | FC(F)(F)COCCN1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C11H19ClF3NO2/c12-3-7-18-10-1-4-16(5-2-10)6-8-17-9-11(13,14)15/h10H,1-9H2 |
| InChIKey | FPZXEIQJOYLBKQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|