C15H20ClF2NO — CID 116790596
4-(2-chloroethoxy)-1-(2,2-difluoro-2-phenylethyl)piperidine (PubChem CID 116790596) has the molecular formula C15H20ClF2NO and a molecular weight of 303.78 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1-(2,2-difluoro-2-phenylethyl)piperidine.
| Compound Name | 4-(2-chloroethoxy)-1-(2,2-difluoro-2-phenylethyl)piperidine |
|---|---|
| PubChem CID | 116790596 |
| Molecular Formula | C15H20ClF2NO |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-(2-chloroethoxy)-1-(2,2-difluoro-2-phenylethyl)piperidine |
| SMILES | FC(F)(CN1CCC(OCCCl)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H20ClF2NO/c16-8-11-20-14-6-9-19(10-7-14)12-15(17,18)13-4-2-1-3-5-13/h1-5,14H,6-12H2 |
| InChIKey | FAZWCHHOGARTKO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|