C15H19F2NO — CID 116789445
1-[1-(2,2-difluoro-2-phenylethyl)piperidin-4-yl]ethanone (PubChem CID 116789445) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-[1-(2,2-difluoro-2-phenylethyl)piperidin-4-yl]ethanone.
| Compound Name | 1-[1-(2,2-difluoro-2-phenylethyl)piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 116789445 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-[1-(2,2-difluoro-2-phenylethyl)piperidin-4-yl]ethanone |
| SMILES | CC(=O)C1CCN(CC(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H19F2NO/c1-12(19)13-7-9-18(10-8-13)11-15(16,17)14-5-3-2-4-6-14/h2-6,13H,7-11H2,1H3 |
| InChIKey | DWQAZHHRRMBIIF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |