C15H20F2N2O2 — CID 116789913
3-[4-(2,2-difluoro-2-phenylethyl)piperazin-1-yl]propanoic acid (PubChem CID 116789913) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 3-[4-(2,2-difluoro-2-phenylethyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(2,2-difluoro-2-phenylethyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 116789913 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[4-(2,2-difluoro-2-phenylethyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(CC(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c16-15(17,13-4-2-1-3-5-13)12-19-10-8-18(9-11-19)7-6-14(20)21/h1-5H,6-12H2,(H,20,21) |
| InChIKey | XTCCZJYKBUBXFI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |