C14H19BrF2N2 — CID 116790576
1-(2-bromoethyl)-4-(2,2-difluoro-2-phenylethyl)piperazine (PubChem CID 116790576) has the molecular formula C14H19BrF2N2 and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(2,2-difluoro-2-phenylethyl)piperazine.
| Compound Name | 1-(2-bromoethyl)-4-(2,2-difluoro-2-phenylethyl)piperazine |
|---|---|
| PubChem CID | 116790576 |
| Molecular Formula | C14H19BrF2N2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(2-bromoethyl)-4-(2,2-difluoro-2-phenylethyl)piperazine |
| SMILES | FC(F)(CN1CCN(CCBr)CC1)c1ccccc1 |
| InChI | InChI=1S/C14H19BrF2N2/c15-6-7-18-8-10-19(11-9-18)12-14(16,17)13-4-2-1-3-5-13/h1-5H,6-12H2 |
| InChIKey | OMHASZYGHBXJDG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|