C15H20F2N2S — CID 107161472
1-(2,2-difluoro-2-phenylethyl)-4-methylpiperidine-4-carbothioamide (PubChem CID 107161472) has the molecular formula C15H20F2N2S and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylethyl)-4-methylpiperidine-4-carbothioamide.
| Compound Name | 1-(2,2-difluoro-2-phenylethyl)-4-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161472 |
| Molecular Formula | C15H20F2N2S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylethyl)-4-methylpiperidine-4-carbothioamide |
| SMILES | CC1(C(N)=S)CCN(CC(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20F2N2S/c1-14(13(18)20)7-9-19(10-8-14)11-15(16,17)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H2,18,20) |
| InChIKey | WVNCMMZKVFEBLV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|