C15H20BrF2N — CID 106838270
4-(1-bromoethyl)-1-(2,2-difluoro-2-phenylethyl)piperidine (PubChem CID 106838270) has the molecular formula C15H20BrF2N and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-(1-bromoethyl)-1-(2,2-difluoro-2-phenylethyl)piperidine.
| Compound Name | 4-(1-bromoethyl)-1-(2,2-difluoro-2-phenylethyl)piperidine |
|---|---|
| PubChem CID | 106838270 |
| Molecular Formula | C15H20BrF2N |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-(1-bromoethyl)-1-(2,2-difluoro-2-phenylethyl)piperidine |
| SMILES | CC(Br)C1CCN(CC(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20BrF2N/c1-12(16)13-7-9-19(10-8-13)11-15(17,18)14-5-3-2-4-6-14/h2-6,12-13H,7-11H2,1H3 |
| InChIKey | AOHYZCBMBSAJPJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|