C13H16ClF3N2O — CID 82701748
2-[4-(2-chloroethoxy)piperidin-1-yl]-3-(trifluoromethyl)pyridine (PubChem CID 82701748) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-[4-(2-chloroethoxy)piperidin-1-yl]-3-(trifluoromethyl)pyridine.
| Compound Name | 2-[4-(2-chloroethoxy)piperidin-1-yl]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 82701748 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[4-(2-chloroethoxy)piperidin-1-yl]-3-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cccnc1N1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C13H16ClF3N2O/c14-5-9-20-10-3-7-19(8-4-10)12-11(13(15,16)17)2-1-6-18-12/h1-2,6,10H,3-5,7-9H2 |
| InChIKey | KRQGRRKJNSRHLV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|