C10H15N7O2S — CID 82702320
[5-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 82702320) has the molecular formula C10H15N7O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is [5-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 82702320 |
| Molecular Formula | C10H15N7O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [5-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | CCc1nn(Cc2nnc(NN)s2)c(CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N7O2S/c1-3-6-9(17(18)19)7(4-2)16(15-6)5-8-13-14-10(12-11)20-8/h3-5,11H2,1-2H3,(H,12,14) |
| InChIKey | WVBRAWCAPWRXTP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|