C13H18ClN5O2 — CID 82692784
5-chloro-4-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3-dimethylpyrazole (PubChem CID 82692784) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 5-chloro-4-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3-dimethylpyrazole.
| Compound Name | 5-chloro-4-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 82692784 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-chloro-4-[(3,5-diethyl-4-nitropyrazol-1-yl)methyl]-1,3-dimethylpyrazole |
| SMILES | CCc1nn(Cc2c(C)nn(C)c2Cl)c(CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18ClN5O2/c1-5-10-12(19(20)21)11(6-2)18(16-10)7-9-8(3)15-17(4)13(9)14/h5-7H2,1-4H3 |
| InChIKey | YOLNNVDBDDCKNX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|