About N-ethoxyundecan-6-amine
N-ethoxyundecan-6-amine (PubChem CID 82709427) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is N-ethoxyundecan-6-amine.
Molecular Properties
| Compound Name | N-ethoxyundecan-6-amine |
| PubChem CID | 82709427 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | N-ethoxyundecan-6-amine |
| SMILES | CCCCCC(CCCCC)NOCC |
| InChI | InChI=1S/C13H29NO/c1-4-7-9-11-13(14-15-6-3)12-10-8-5-2/h13-14H,4-12H2,1-3H3 |
| InChIKey | WEWNTFVEMPMDPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxyundecan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxyundecan-6-amine?
The IUPAC name of N-ethoxyundecan-6-amine (CID 82709427) is N-ethoxyundecan-6-amine.
What is the SMILES notation for N-ethoxyundecan-6-amine?
The canonical SMILES for N-ethoxyundecan-6-amine is CCCCCC(CCCCC)NOCC.
What is the InChIKey of N-ethoxyundecan-6-amine?
The InChIKey is WEWNTFVEMPMDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-4-7-9-11-13(14-15-6-3)12-10-8-5-2/h13-14H,4-12H2,1-3H3.
What are the key properties of N-ethoxyundecan-6-amine?
N-ethoxyundecan-6-amine has a molecular weight of 215.38 g/mol, XLogP of 4.06, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxyundecan-6-amine is sourced from PubChem (CID 82709427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).