About N-ethoxyoctan-2-amine
N-ethoxyoctan-2-amine (PubChem CID 82709858) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is N-ethoxyoctan-2-amine.
Molecular Properties
| Compound Name | N-ethoxyoctan-2-amine |
| PubChem CID | 82709858 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | N-ethoxyoctan-2-amine |
| SMILES | CCCCCCC(C)NOCC |
| InChI | InChI=1S/C10H23NO/c1-4-6-7-8-9-10(3)11-12-5-2/h10-11H,4-9H2,1-3H3 |
| InChIKey | MZLCSOATYXLQMM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxyoctan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxyoctan-2-amine?
The IUPAC name of N-ethoxyoctan-2-amine (CID 82709858) is N-ethoxyoctan-2-amine.
What is the SMILES notation for N-ethoxyoctan-2-amine?
The canonical SMILES for N-ethoxyoctan-2-amine is CCCCCCC(C)NOCC.
What is the InChIKey of N-ethoxyoctan-2-amine?
The InChIKey is MZLCSOATYXLQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-4-6-7-8-9-10(3)11-12-5-2/h10-11H,4-9H2,1-3H3.
What are the key properties of N-ethoxyoctan-2-amine?
N-ethoxyoctan-2-amine has a molecular weight of 173.30 g/mol, XLogP of 2.89, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxyoctan-2-amine is sourced from PubChem (CID 82709858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).