About N-fluorooctan-2-amine
N-fluorooctan-2-amine (PubChem CID 88597566) has the molecular formula C8H18FN
and a molecular weight of 147.24 g/mol. Its IUPAC name is N-fluorooctan-2-amine.
Molecular Properties
| Compound Name | N-fluorooctan-2-amine |
| PubChem CID | 88597566 |
| Molecular Formula | C8H18FN |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | N-fluorooctan-2-amine |
| SMILES | CCCCCCC(C)NF |
| InChI | InChI=1S/C8H18FN/c1-3-4-5-6-7-8(2)10-9/h8,10H,3-7H2,1-2H3 |
| InChIKey | BWNDEBNPSYVSNQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluorooctan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluorooctan-2-amine?
The IUPAC name of N-fluorooctan-2-amine (CID 88597566) is N-fluorooctan-2-amine.
What is the SMILES notation for N-fluorooctan-2-amine?
The canonical SMILES for N-fluorooctan-2-amine is CCCCCCC(C)NF.
What is the InChIKey of N-fluorooctan-2-amine?
The InChIKey is BWNDEBNPSYVSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18FN/c1-3-4-5-6-7-8(2)10-9/h8,10H,3-7H2,1-2H3.
What are the key properties of N-fluorooctan-2-amine?
N-fluorooctan-2-amine has a molecular weight of 147.24 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluorooctan-2-amine is sourced from PubChem (CID 88597566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).