About N-bromodecan-2-amine
N-bromodecan-2-amine (PubChem CID 150287649) has the molecular formula C10H22BrN
and a molecular weight of 236.20 g/mol. Its IUPAC name is N-bromodecan-2-amine.
Molecular Properties
| Compound Name | N-bromodecan-2-amine |
| PubChem CID | 150287649 |
| Molecular Formula | C10H22BrN |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-bromodecan-2-amine |
| SMILES | CCCCCCCCC(C)NBr |
| InChI | InChI=1S/C10H22BrN/c1-3-4-5-6-7-8-9-10(2)12-11/h10,12H,3-9H2,1-2H3 |
| InChIKey | IPWHCXFAGPMWGY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromodecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromodecan-2-amine?
The IUPAC name of N-bromodecan-2-amine (CID 150287649) is N-bromodecan-2-amine.
What is the SMILES notation for N-bromodecan-2-amine?
The canonical SMILES for N-bromodecan-2-amine is CCCCCCCCC(C)NBr.
What is the InChIKey of N-bromodecan-2-amine?
The InChIKey is IPWHCXFAGPMWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22BrN/c1-3-4-5-6-7-8-9-10(2)12-11/h10,12H,3-9H2,1-2H3.
What are the key properties of N-bromodecan-2-amine?
N-bromodecan-2-amine has a molecular weight of 236.20 g/mol, XLogP of 4.03, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromodecan-2-amine is sourced from PubChem (CID 150287649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).