C9H11F2NO2 — CID 82709745
4-[(ethoxyamino)methyl]-2,6-difluorophenol (PubChem CID 82709745) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 4-[(ethoxyamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(ethoxyamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 82709745 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-[(ethoxyamino)methyl]-2,6-difluorophenol |
| SMILES | CCONCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C9H11F2NO2/c1-2-14-12-5-6-3-7(10)9(13)8(11)4-6/h3-4,12-13H,2,5H2,1H3 |
| InChIKey | LZFSVBZXQLXHTN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|