C10H21NO2S — CID 82710921
N-(2-methoxyethoxy)-4,4-dimethylthian-3-amine (PubChem CID 82710921) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-4,4-dimethylthian-3-amine.
| Compound Name | N-(2-methoxyethoxy)-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 82710921 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(2-methoxyethoxy)-4,4-dimethylthian-3-amine |
| SMILES | COCCONC1CSCCC1(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-10(2)4-7-14-8-9(10)11-13-6-5-12-3/h9,11H,4-8H2,1-3H3 |
| InChIKey | AWZUHOWBQSIYBG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|