C16H14BrFN2O — CID 82711987
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-5-fluorophenyl)methanone (PubChem CID 82711987) has the molecular formula C16H14BrFN2O and a molecular weight of 349.20 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-5-fluorophenyl)methanone.
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 82711987 |
| Molecular Formula | C16H14BrFN2O |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-5-fluorophenyl)methanone |
| SMILES | Nc1cccc2c1CCCN2C(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C16H14BrFN2O/c17-13-7-6-10(18)9-12(13)16(21)20-8-2-3-11-14(19)4-1-5-15(11)20/h1,4-7,9H,2-3,8,19H2 |
| InChIKey | TVYAQELEURIOEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|