C8H14N2O5S — CID 82714251
N-(2-methoxyethoxy)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 82714251) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide.
| Compound Name | N-(2-methoxyethoxy)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 82714251 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(2-methoxyethoxy)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | COCCONS(=O)(=O)Cc1cc(C)on1 |
| InChI | InChI=1S/C8H14N2O5S/c1-7-5-8(9-15-7)6-16(11,12)10-14-4-3-13-2/h5,10H,3-4,6H2,1-2H3 |
| InChIKey | OOIUAAQGZJVKGH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|