C12H23N3O — CID 82719907
N-[(2-methylpropan-2-yl)oxy]-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 82719907) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[(2-methylpropan-2-yl)oxy]-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-[(2-methylpropan-2-yl)oxy]-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82719907 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-[(2-methylpropan-2-yl)oxy]-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1C(C)NOC(C)(C)C |
| InChI | InChI=1S/C12H23N3O/c1-8-11(10(3)15(7)13-8)9(2)14-16-12(4,5)6/h9,14H,1-7H3 |
| InChIKey | KOWIEGRPHSKYGX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|