C9H17F3N2O2 — CID 82721531
N-(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxyamino)acetamide (PubChem CID 82721531) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxyamino)acetamide.
| Compound Name | N-(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxyamino)acetamide |
|---|---|
| PubChem CID | 82721531 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxyamino)acetamide |
| SMILES | CCC(C)(C)NC(=O)CNOCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-4-8(2,3)14-7(15)5-13-16-6-9(10,11)12/h13H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | CIQUKVWVXPTPFB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|