C6H10F3NO4 — CID 104644918
2-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxyamino)propanoic acid (PubChem CID 104644918) has the molecular formula C6H10F3NO4 and a molecular weight of 217.14 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxyamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxyamino)propanoic acid |
|---|---|
| PubChem CID | 104644918 |
| Molecular Formula | C6H10F3NO4 |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(2,2,2-trifluoroethoxyamino)propanoic acid |
| SMILES | CC(O)(CNOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H10F3NO4/c1-5(13,4(11)12)2-10-14-3-6(7,8)9/h10,13H,2-3H2,1H3,(H,11,12) |
| InChIKey | PRUZLCLCXYBYBZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|