C10H19F3N2O2 — CID 82722236
N-pentyl-2-(2,2,2-trifluoroethoxyamino)propanamide (PubChem CID 82722236) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-pentyl-2-(2,2,2-trifluoroethoxyamino)propanamide.
| Compound Name | N-pentyl-2-(2,2,2-trifluoroethoxyamino)propanamide |
|---|---|
| PubChem CID | 82722236 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-pentyl-2-(2,2,2-trifluoroethoxyamino)propanamide |
| SMILES | CCCCCNC(=O)C(C)NOCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-3-4-5-6-14-9(16)8(2)15-17-7-10(11,12)13/h8,15H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | FLTHXSSMSQPIQH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|