C10H21NO3 — CID 82724655
methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate (PubChem CID 82724655) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate |
|---|---|
| PubChem CID | 82724655 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate |
| SMILES | COC(=O)C(C)(C)CNOC(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-9(2,3)14-11-7-10(4,5)8(12)13-6/h11H,7H2,1-6H3 |
| InChIKey | UKCHOJVVXKPPAU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|