methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate

C10H21NO3 — CID 82724655

IUPACmethyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate
SMILESCOC(=O)C(C)(C)CNOC(C)(C)C
InChIInChI=1S/C10H21NO3/c1-9(2,3)14-11-7-10(4,5)8(12)13-6/h11H,7H2,1-6H3
InChIKeyUKCHOJVVXKPPAU-UHFFFAOYSA-N
MW203.28 g/mol
LogP1.51
Rot. Bonds4

About methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate

methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate (PubChem CID 82724655) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate
PubChem CID82724655
Molecular FormulaC10H21NO3
Molecular Weight203.28 g/mol
Exact Mass203.15
IUPAC Namemethyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate
SMILESCOC(=O)C(C)(C)CNOC(C)(C)C
InChIInChI=1S/C10H21NO3/c1-9(2,3)14-11-7-10(4,5)8(12)13-6/h11H,7H2,1-6H3
InChIKeyUKCHOJVVXKPPAU-UHFFFAOYSA-N
XLogP1.51
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.28
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate?
The IUPAC name of methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate (CID 82724655) is methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate is COC(=O)C(C)(C)CNOC(C)(C)C.
What is the InChIKey of methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate?
The InChIKey is UKCHOJVVXKPPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c1-9(2,3)14-11-7-10(4,5)8(12)13-6/h11H,7H2,1-6H3.
What are the key properties of methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate?
methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate has a molecular weight of 203.28 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxyamino]propanoate is sourced from PubChem (CID 82724655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).