C13H21NO4 — CID 82726496
1-(furan-2-ylmethoxy)-3-[(2-methyloxolan-3-yl)amino]propan-2-ol (PubChem CID 82726496) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-(furan-2-ylmethoxy)-3-[(2-methyloxolan-3-yl)amino]propan-2-ol.
| Compound Name | 1-(furan-2-ylmethoxy)-3-[(2-methyloxolan-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 82726496 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-(furan-2-ylmethoxy)-3-[(2-methyloxolan-3-yl)amino]propan-2-ol |
| SMILES | CC1OCCC1NCC(O)COCc1ccco1 |
| InChI | InChI=1S/C13H21NO4/c1-10-13(4-6-17-10)14-7-11(15)8-16-9-12-3-2-5-18-12/h2-3,5,10-11,13-15H,4,6-9H2,1H3 |
| InChIKey | HXFPCLMPUKUKDB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |