C14H20FN3O2 — CID 82732986
N-(2-amino-4-fluorophenyl)-2-[methyl-(2-methyloxolan-3-yl)amino]acetamide (PubChem CID 82732986) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-[methyl-(2-methyloxolan-3-yl)amino]acetamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-[methyl-(2-methyloxolan-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 82732986 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-[methyl-(2-methyloxolan-3-yl)amino]acetamide |
| SMILES | CC1OCCC1N(C)CC(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C14H20FN3O2/c1-9-13(5-6-20-9)18(2)8-14(19)17-12-4-3-10(15)7-11(12)16/h3-4,7,9,13H,5-6,8,16H2,1-2H3,(H,17,19) |
| InChIKey | ISPISWGXXYKKMT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|