C13H21N3 — CID 82733670
3-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentane-1,3-diamine (PubChem CID 82733670) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentane-1,3-diamine.
| Compound Name | 3-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 82733670 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentane-1,3-diamine |
| SMILES | CCc1cccnc1CNC1CCC(N)C1 |
| InChI | InChI=1S/C13H21N3/c1-2-10-4-3-7-15-13(10)9-16-12-6-5-11(14)8-12/h3-4,7,11-12,16H,2,5-6,8-9,14H2,1H3 |
| InChIKey | VEFWLSBHRSBEOW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |