C11H22N2O — CID 82739830
N-(cyclopropylmethyl)-N'-methyl-N'-(oxolan-3-yl)ethane-1,2-diamine (PubChem CID 82739830) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-methyl-N'-(oxolan-3-yl)ethane-1,2-diamine.
| Compound Name | N-(cyclopropylmethyl)-N'-methyl-N'-(oxolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82739830 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-methyl-N'-(oxolan-3-yl)ethane-1,2-diamine |
| SMILES | CN(CCNCC1CC1)C1CCOC1 |
| InChI | InChI=1S/C11H22N2O/c1-13(11-4-7-14-9-11)6-5-12-8-10-2-3-10/h10-12H,2-9H2,1H3 |
| InChIKey | CMOKBFIHTGGZJS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|