C10H20N2O — CID 82739917
N'-methyl-N'-(oxolan-3-yl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 82739917) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N'-methyl-N'-(oxolan-3-yl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(oxolan-3-yl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 82739917 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N'-methyl-N'-(oxolan-3-yl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNCCN(C)C1CCOC1 |
| InChI | InChI=1S/C10H20N2O/c1-3-5-11-6-7-12(2)10-4-8-13-9-10/h3,10-11H,1,4-9H2,2H3 |
| InChIKey | YXWZLRZAONITGR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|