C12H13N3O — CID 82740620
[2-(3-ethyl-2-pyridinyl)pyrimidin-4-yl]methanol (PubChem CID 82740620) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is [2-(3-ethyl-2-pyridinyl)pyrimidin-4-yl]methanol.
| Compound Name | [2-(3-ethyl-2-pyridinyl)pyrimidin-4-yl]methanol |
|---|---|
| PubChem CID | 82740620 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [2-(3-ethyl-2-pyridinyl)pyrimidin-4-yl]methanol |
| SMILES | CCc1cccnc1-c1nccc(CO)n1 |
| InChI | InChI=1S/C12H13N3O/c1-2-9-4-3-6-13-11(9)12-14-7-5-10(8-16)15-12/h3-7,16H,2,8H2,1H3 |
| InChIKey | DWVCNXAZOOIBKI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |