C15H20N4 — CID 82741419
2-(3-ethyl-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine (PubChem CID 82741419) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(3-ethyl-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(3-ethyl-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82741419 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-(3-ethyl-2-pyridinyl)-6-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(C)nc(-c2ncccc2CC)n1 |
| InChI | InChI=1S/C15H20N4/c1-4-8-16-13-10-11(3)18-15(19-13)14-12(5-2)7-6-9-17-14/h6-7,9-10H,4-5,8H2,1-3H3,(H,16,18,19) |
| InChIKey | AKBMDDISYUWFEV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |