C11H16BrNO4S2 — CID 82745499
2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-3-sulfonamide (PubChem CID 82745499) has the molecular formula C11H16BrNO4S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 82745499 |
| Molecular Formula | C11H16BrNO4S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-3-sulfonamide |
| SMILES | CC1OCCC1N(C)S(=O)(=O)c1cc(CO)sc1Br |
| InChI | InChI=1S/C11H16BrNO4S2/c1-7-9(3-4-17-7)13(2)19(15,16)10-5-8(6-14)18-11(10)12/h5,7,9,14H,3-4,6H2,1-2H3 |
| InChIKey | NIXQIEAOQOVSPD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |