C11H16ClNO3S2 — CID 82745504
5-(chloromethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-2-sulfonamide (PubChem CID 82745504) has the molecular formula C11H16ClNO3S2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 5-(chloromethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(chloromethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 82745504 |
| Molecular Formula | C11H16ClNO3S2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 5-(chloromethyl)-N-methyl-N-(2-methyloxolan-3-yl)thiophene-2-sulfonamide |
| SMILES | CC1OCCC1N(C)S(=O)(=O)c1ccc(CCl)s1 |
| InChI | InChI=1S/C11H16ClNO3S2/c1-8-10(5-6-16-8)13(2)18(14,15)11-4-3-9(7-12)17-11/h3-4,8,10H,5-7H2,1-2H3 |
| InChIKey | WSSWZQZSGDTGEQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|