C11H15NO5S — CID 82744699
5-formyl-N-methyl-N-(2-methyloxolan-3-yl)furan-2-sulfonamide (PubChem CID 82744699) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-formyl-N-methyl-N-(2-methyloxolan-3-yl)furan-2-sulfonamide.
| Compound Name | 5-formyl-N-methyl-N-(2-methyloxolan-3-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 82744699 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-formyl-N-methyl-N-(2-methyloxolan-3-yl)furan-2-sulfonamide |
| SMILES | CC1OCCC1N(C)S(=O)(=O)c1ccc(C=O)o1 |
| InChI | InChI=1S/C11H15NO5S/c1-8-10(5-6-16-8)12(2)18(14,15)11-4-3-9(7-13)17-11/h3-4,7-8,10H,5-6H2,1-2H3 |
| InChIKey | OZVVPLLOHNSJOA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|