C15H20BrF3N2 — CID 82745786
N-[1-(aminomethyl)-4-(trifluoromethyl)cyclohexyl]-2-bromo-5-methylaniline (PubChem CID 82745786) has the molecular formula C15H20BrF3N2 and a molecular weight of 365.24 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-(trifluoromethyl)cyclohexyl]-2-bromo-5-methylaniline.
| Compound Name | N-[1-(aminomethyl)-4-(trifluoromethyl)cyclohexyl]-2-bromo-5-methylaniline |
|---|---|
| PubChem CID | 82745786 |
| Molecular Formula | C15H20BrF3N2 |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-[1-(aminomethyl)-4-(trifluoromethyl)cyclohexyl]-2-bromo-5-methylaniline |
| SMILES | Cc1ccc(Br)c(NC2(CN)CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C15H20BrF3N2/c1-10-2-3-12(16)13(8-10)21-14(9-20)6-4-11(5-7-14)15(17,18)19/h2-3,8,11,21H,4-7,9,20H2,1H3 |
| InChIKey | PURIBKQMDJEPNX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |