C15H22N2 — CID 82747611
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylaniline (PubChem CID 82747611) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylaniline.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylaniline |
|---|---|
| PubChem CID | 82747611 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-methylaniline |
| SMILES | Cc1ccc(N)c(N2CCC3CCCCC32)c1 |
| InChI | InChI=1S/C15H22N2/c1-11-6-7-13(16)15(10-11)17-9-8-12-4-2-3-5-14(12)17/h6-7,10,12,14H,2-5,8-9,16H2,1H3 |
| InChIKey | OMYQXOCUXDIBIK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|