C16H20N2 — CID 114016920
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methylbenzonitrile (PubChem CID 114016920) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methylbenzonitrile.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methylbenzonitrile |
|---|---|
| PubChem CID | 114016920 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methylbenzonitrile |
| SMILES | Cc1ccc(N2CCC3CCCCC32)c(C#N)c1 |
| InChI | InChI=1S/C16H20N2/c1-12-6-7-16(14(10-12)11-17)18-9-8-13-4-2-3-5-15(13)18/h6-7,10,13,15H,2-5,8-9H2,1H3 |
| InChIKey | FJEHZSHMZWMVGK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |