C10H16IN3O2 — CID 82748424
N,3-dimethyl-N-(oxolan-3-yl)imidazol-3-ium-1-carboxamide iodide (PubChem CID 82748424) has the molecular formula C10H16IN3O2 and a molecular weight of 337.16 g/mol. Its IUPAC name is N,3-dimethyl-N-(oxolan-3-yl)imidazol-3-ium-1-carboxamide iodide.
| Compound Name | N,3-dimethyl-N-(oxolan-3-yl)imidazol-3-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 82748424 |
| Molecular Formula | C10H16IN3O2 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N,3-dimethyl-N-(oxolan-3-yl)imidazol-3-ium-1-carboxamide iodide |
| SMILES | CN(C(=O)n1cc[n+](C)c1)C1CCOC1.[I-] |
| InChI | InChI=1S/C10H16N3O2.HI/c1-11-4-5-13(8-11)10(14)12(2)9-3-6-15-7-9;/h4-5,8-9H,3,6-7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SQMNRJYVRANYMR-UHFFFAOYSA-M |
| XLogP | -2.99 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|