C13H15ClFNO4S — CID 82749001
2-fluoro-3-methyl-5-[methyl(oxolan-3-yl)carbamoyl]benzenesulfonyl chloride (PubChem CID 82749001) has the molecular formula C13H15ClFNO4S and a molecular weight of 335.78 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-[methyl(oxolan-3-yl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 2-fluoro-3-methyl-5-[methyl(oxolan-3-yl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82749001 |
| Molecular Formula | C13H15ClFNO4S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-fluoro-3-methyl-5-[methyl(oxolan-3-yl)carbamoyl]benzenesulfonyl chloride |
| SMILES | Cc1cc(C(=O)N(C)C2CCOC2)cc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C13H15ClFNO4S/c1-8-5-9(6-11(12(8)15)21(14,18)19)13(17)16(2)10-3-4-20-7-10/h5-6,10H,3-4,7H2,1-2H3 |
| InChIKey | BVJZVROLYVDWEB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |