C12H18N4O — CID 82750781
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(5-amino-1H-pyrazol-4-yl)methanone (PubChem CID 82750781) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(5-amino-1H-pyrazol-4-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(5-amino-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 82750781 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(5-amino-1H-pyrazol-4-yl)methanone |
| SMILES | Nc1[nH]ncc1C(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C12H18N4O/c13-11-9(7-14-15-11)12(17)16-6-5-8-3-1-2-4-10(8)16/h7-8,10H,1-6H2,(H3,13,14,15) |
| InChIKey | DKADBYYDCDGPKK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |