C16H19N3OS — CID 82752576
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-aminothieno[2,3-c]pyridin-2-yl)methanone (PubChem CID 82752576) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-aminothieno[2,3-c]pyridin-2-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-aminothieno[2,3-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 82752576 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-aminothieno[2,3-c]pyridin-2-yl)methanone |
| SMILES | Nc1c(C(=O)N2CCC3CCCCC32)sc2cnccc12 |
| InChI | InChI=1S/C16H19N3OS/c17-14-11-5-7-18-9-13(11)21-15(14)16(20)19-8-6-10-3-1-2-4-12(10)19/h5,7,9-10,12H,1-4,6,8,17H2 |
| InChIKey | CWOYONXVWAQUHZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |