About hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate
hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate (PubChem CID 82754758) has the molecular formula C8H17N3O3
and a molecular weight of 203.24 g/mol. Its IUPAC name is hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate.
Molecular Properties
| Compound Name | hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate |
| PubChem CID | 82754758 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate |
| SMILES | CN(CCC(=O)ONN)C1CCOC1 |
| InChI | InChI=1S/C8H17N3O3/c1-11(7-3-5-13-6-7)4-2-8(12)14-10-9/h7,10H,2-6,9H2,1H3 |
| InChIKey | LNVLOTAXBWIJMO-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate?
The IUPAC name of hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate (CID 82754758) is hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate.
What is the SMILES notation for hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate?
The canonical SMILES for hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate is CN(CCC(=O)ONN)C1CCOC1.
What is the InChIKey of hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate?
The InChIKey is LNVLOTAXBWIJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O3/c1-11(7-3-5-13-6-7)4-2-8(12)14-10-9/h7,10H,2-6,9H2,1H3.
What are the key properties of hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate?
hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate has a molecular weight of 203.24 g/mol, XLogP of -0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinyl 3-[methyl(oxolan-3-yl)amino]propanoate is sourced from PubChem (CID 82754758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).