C14H17BrClN3 — CID 82757818
2-bromo-N-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-methylaniline (PubChem CID 82757818) has the molecular formula C14H17BrClN3 and a molecular weight of 342.67 g/mol. Its IUPAC name is 2-bromo-N-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-methylaniline.
| Compound Name | 2-bromo-N-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-methylaniline |
|---|---|
| PubChem CID | 82757818 |
| Molecular Formula | C14H17BrClN3 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-bromo-N-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-methylaniline |
| SMILES | CCc1nn(C)c(CNc2cc(C)ccc2Br)c1Cl |
| InChI | InChI=1S/C14H17BrClN3/c1-4-11-14(16)13(19(3)18-11)8-17-12-7-9(2)5-6-10(12)15/h5-7,17H,4,8H2,1-3H3 |
| InChIKey | PWULIGZOJYBXNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |