C14H14ClFN4 — CID 82016193
2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-5-fluorobenzonitrile (PubChem CID 82016193) has the molecular formula C14H14ClFN4 and a molecular weight of 292.75 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-5-fluorobenzonitrile.
| Compound Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 82016193 |
| Molecular Formula | C14H14ClFN4 |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-5-fluorobenzonitrile |
| SMILES | CCc1nn(C)c(CNc2ccc(F)cc2C#N)c1Cl |
| InChI | InChI=1S/C14H14ClFN4/c1-3-11-14(15)13(20(2)19-11)8-18-12-5-4-10(16)6-9(12)7-17/h4-6,18H,3,8H2,1-2H3 |
| InChIKey | YFJGQYQTOMZTFP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |