C14H24N2O5 — CID 82763992
2-[[(3-ethoxy-3-oxopropyl)-methylcarbamoyl]amino]-1-methylcyclopentane-1-carboxylic acid (PubChem CID 82763992) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[[(3-ethoxy-3-oxopropyl)-methylcarbamoyl]amino]-1-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[[(3-ethoxy-3-oxopropyl)-methylcarbamoyl]amino]-1-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 82763992 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[[(3-ethoxy-3-oxopropyl)-methylcarbamoyl]amino]-1-methylcyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)CCN(C)C(=O)NC1CCCC1(C)C(=O)O |
| InChI | InChI=1S/C14H24N2O5/c1-4-21-11(17)7-9-16(3)13(20)15-10-6-5-8-14(10,2)12(18)19/h10H,4-9H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | HNGMMAZICPBCGT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |