C13H20N4O3 — CID 82764931
1-methyl-2-[[methyl(1H-pyrazol-4-ylmethyl)carbamoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 82764931) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-methyl-2-[[methyl(1H-pyrazol-4-ylmethyl)carbamoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-methyl-2-[[methyl(1H-pyrazol-4-ylmethyl)carbamoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 82764931 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-methyl-2-[[methyl(1H-pyrazol-4-ylmethyl)carbamoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CN(Cc1cn[nH]c1)C(=O)NC1CCCC1(C)C(=O)O |
| InChI | InChI=1S/C13H20N4O3/c1-13(11(18)19)5-3-4-10(13)16-12(20)17(2)8-9-6-14-15-7-9/h6-7,10H,3-5,8H2,1-2H3,(H,14,15)(H,16,20)(H,18,19) |
| InChIKey | DGTSGDLYSQEEQG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |